C10H16N5O11P3S — CID 52944171
[[(2S,3R,5R)-5-(6-aminopurin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphinothioyl] phosphono hydrogen phosphate (PubChem CID 52944171) has the molecular formula C10H16N5O11P3S and a molecular weight of 507.25 g/mol. Its IUPAC name is [[(2S,3R,5R)-5-(6-aminopurin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphinothioyl] phosphono hydrogen phosphate.
| Compound Name | [[(2S,3R,5R)-5-(6-aminopurin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphinothioyl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 52944171 |
| Molecular Formula | C10H16N5O11P3S |
| Molecular Weight | 507.25 g/mol |
| Exact Mass | 506.98 |
| IUPAC Name | [[(2S,3R,5R)-5-(6-aminopurin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphinothioyl] phosphono hydrogen phosphate |
| SMILES | Nc1ncnc2c1ncn2[C@H]1C[C@@H](O)[C@H](COP(O)(=S)OP(=O)(O)OP(=O)(O)O)O1 |
| InChI | InChI=1S/C10H16N5O11P3S/c11-9-8-10(13-3-12-9)15(4-14-8)7-1-5(16)6(24-7)2-23-29(22,30)26-28(20,21)25-27(17,18)19/h3-7,16H,1-2H2,(H,20,21)(H,22,30)(H2,11,12,13)(H2,17,18,19)/t5-,6+,7-,29?/m1/s1 |
| InChIKey | CCPIKNHZOWQALM-INTQAABWSA-N |
| XLogP | -0.48 |
| TPSA | 241.83 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.25 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|