C10H12N5O3PS — CID 153461808
(2R,3S,5R)-5-(6-aminopurin-9-yl)-2-(thiophosphorosooxymethyl)oxolan-3-ol (PubChem CID 153461808) has the molecular formula C10H12N5O3PS and a molecular weight of 313.28 g/mol. Its IUPAC name is (2R,3S,5R)-5-(6-aminopurin-9-yl)-2-(thiophosphorosooxymethyl)oxolan-3-ol.
| Compound Name | (2R,3S,5R)-5-(6-aminopurin-9-yl)-2-(thiophosphorosooxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 153461808 |
| Molecular Formula | C10H12N5O3PS |
| Molecular Weight | 313.28 g/mol |
| Exact Mass | 313.04 |
| IUPAC Name | (2R,3S,5R)-5-(6-aminopurin-9-yl)-2-(thiophosphorosooxymethyl)oxolan-3-ol |
| SMILES | Nc1ncnc2c1ncn2[C@H]1C[C@H](O)[C@@H](COP=S)O1 |
| InChI | InChI=1S/C10H12N5O3PS/c11-9-8-10(13-3-12-9)15(4-14-8)7-1-5(16)6(18-7)2-17-19-20/h3-7,16H,1-2H2,(H2,11,12,13)/t5-,6+,7+/m0/s1 |
| InChIKey | ZIHULFXNNRXOOZ-RRKCRQDMSA-N |
| XLogP | 0.40 |
| TPSA | 108.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.28 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|