C10H14N5O11P3+2 — CID 57355659
[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-[hydroxy-[hydroxy(oxo)phosphaniumyl]oxyphosphoryl]oxy-oxophosphanium (PubChem CID 57355659) has the molecular formula C10H14N5O11P3+2 and a molecular weight of 473.17 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-[hydroxy-[hydroxy(oxo)phosphaniumyl]oxyphosphoryl]oxy-oxophosphanium.
| Compound Name | [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-[hydroxy-[hydroxy(oxo)phosphaniumyl]oxyphosphoryl]oxy-oxophosphanium |
|---|---|
| PubChem CID | 57355659 |
| Molecular Formula | C10H14N5O11P3+2 |
| Molecular Weight | 473.17 g/mol |
| Exact Mass | 472.99 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-[hydroxy-[hydroxy(oxo)phosphaniumyl]oxyphosphoryl]oxy-oxophosphanium |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](CO[P+](=O)OP(=O)(O)O[P+](=O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C10H12N5O11P3/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(24-10)1-23-28(20)26-29(21,22)25-27(18)19/h2-4,6-7,10,16-17H,1H2,(H2-2,11,12,13,18,19,21,22)/p+2/t4-,6-,7-,10-/m1/s1 |
| InChIKey | KDJLVZYHRGPIFO-KQYNXXCUSA-P |
| XLogP | -0.51 |
| TPSA | 238.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.17 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|