C11H15N5O4S — CID 145155590
(3R,4S)-2-(6-aminopurin-9-yl)-5-(sulfanylmethoxymethyl)oxolane-3,4-diol (PubChem CID 145155590) has the molecular formula C11H15N5O4S and a molecular weight of 313.34 g/mol. Its IUPAC name is (3R,4S)-2-(6-aminopurin-9-yl)-5-(sulfanylmethoxymethyl)oxolane-3,4-diol.
| Compound Name | (3R,4S)-2-(6-aminopurin-9-yl)-5-(sulfanylmethoxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 145155590 |
| Molecular Formula | C11H15N5O4S |
| Molecular Weight | 313.34 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | (3R,4S)-2-(6-aminopurin-9-yl)-5-(sulfanylmethoxymethyl)oxolane-3,4-diol |
| SMILES | Nc1ncnc2c1ncn2C1OC(COCS)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C11H15N5O4S/c12-9-6-10(14-2-13-9)16(3-15-6)11-8(18)7(17)5(20-11)1-19-4-21/h2-3,5,7-8,11,17-18,21H,1,4H2,(H2,12,13,14)/t5?,7-,8-,11?/m1/s1 |
| InChIKey | STZYWGDASVXBGB-YJTBBNRCSA-N |
| XLogP | -1.07 |
| TPSA | 128.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.34 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|