C10H13N5O3S — CID 59737005
(2R,3S,5S)-2-(6-aminopurin-9-yl)-5-(sulfanylmethyl)oxolane-3,4-diol (PubChem CID 59737005) has the molecular formula C10H13N5O3S and a molecular weight of 283.31 g/mol. Its IUPAC name is (2R,3S,5S)-2-(6-aminopurin-9-yl)-5-(sulfanylmethyl)oxolane-3,4-diol.
| Compound Name | (2R,3S,5S)-2-(6-aminopurin-9-yl)-5-(sulfanylmethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 59737005 |
| Molecular Formula | C10H13N5O3S |
| Molecular Weight | 283.31 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | (2R,3S,5S)-2-(6-aminopurin-9-yl)-5-(sulfanylmethyl)oxolane-3,4-diol |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](CS)C(O)[C@@H]1O |
| InChI | InChI=1S/C10H13N5O3S/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(1-19)18-10/h2-4,6-7,10,16-17,19H,1H2,(H2,11,12,13)/t4-,6?,7+,10-/m1/s1 |
| InChIKey | HLJHWWUZHBUUAC-HMEJCUHCSA-N |
| XLogP | -1.04 |
| TPSA | 119.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.31 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|