C11H13N5O5 — CID 57250654
[(2R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl formate (PubChem CID 57250654) has the molecular formula C11H13N5O5 and a molecular weight of 295.26 g/mol. Its IUPAC name is [(2R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl formate.
| Compound Name | [(2R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl formate |
|---|---|
| PubChem CID | 57250654 |
| Molecular Formula | C11H13N5O5 |
| Molecular Weight | 295.26 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | [(2R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl formate |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COC=O)C(O)C1O |
| InChI | InChI=1S/C11H13N5O5/c12-9-6-10(14-2-13-9)16(3-15-6)11-8(19)7(18)5(21-11)1-20-4-17/h2-5,7-8,11,18-19H,1H2,(H2,12,13,14)/t5-,7?,8?,11-/m1/s1 |
| InChIKey | DZKSMXWWERZQLU-VTFQDDHLSA-N |
| XLogP | -1.80 |
| TPSA | 145.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.26 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|