C17H18N5O8P — CID 11683836
[(2R,3R,4R,5R)-2-(6-aminopurin-9-yl)-4-hydroxy-5-(phosphonooxymethyl)oxolan-3-yl] benzoate (PubChem CID 11683836) has the molecular formula C17H18N5O8P and a molecular weight of 451.33 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-2-(6-aminopurin-9-yl)-4-hydroxy-5-(phosphonooxymethyl)oxolan-3-yl] benzoate.
| Compound Name | [(2R,3R,4R,5R)-2-(6-aminopurin-9-yl)-4-hydroxy-5-(phosphonooxymethyl)oxolan-3-yl] benzoate |
|---|---|
| PubChem CID | 11683836 |
| Molecular Formula | C17H18N5O8P |
| Molecular Weight | 451.33 g/mol |
| Exact Mass | 451.09 |
| IUPAC Name | [(2R,3R,4R,5R)-2-(6-aminopurin-9-yl)-4-hydroxy-5-(phosphonooxymethyl)oxolan-3-yl] benzoate |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)O)[C@@H](O)[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C17H18N5O8P/c18-14-11-15(20-7-19-14)22(8-21-11)16-13(30-17(24)9-4-2-1-3-5-9)12(23)10(29-16)6-28-31(25,26)27/h1-5,7-8,10,12-13,16,23H,6H2,(H2,18,19,20)(H2,25,26,27)/t10-,12-,13-,16-/m1/s1 |
| InChIKey | VXDUSOPUODHZPJ-XNIJJKJLSA-N |
| XLogP | 0.00 |
| TPSA | 192.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.33 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|