C24H26N5O13P3S — CID 11571241
[(2R,3R,4R,5R)-2-(6-aminopurin-9-yl)-5-[[[dihydroxyphosphinothioyloxy(hydroxy)phosphoryl]oxy-hydroxyphosphoryl]oxymethyl]-4-hydroxyoxolan-3-yl] 4-benzylbenzoate (PubChem CID 11571241) has the molecular formula C24H26N5O13P3S and a molecular weight of 717.48 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-2-(6-aminopurin-9-yl)-5-[[[dihydroxyphosphinothioyloxy(hydroxy)phosphoryl]oxy-hydroxyphosphoryl]oxymethyl]-4-hydroxyoxolan-3-yl] 4-benzylbenzoate.
| Compound Name | [(2R,3R,4R,5R)-2-(6-aminopurin-9-yl)-5-[[[dihydroxyphosphinothioyloxy(hydroxy)phosphoryl]oxy-hydroxyphosphoryl]oxymethyl]-4-hydroxyoxolan-3-yl] 4-benzylbenzoate |
|---|---|
| PubChem CID | 11571241 |
| Molecular Formula | C24H26N5O13P3S |
| Molecular Weight | 717.48 g/mol |
| Exact Mass | 717.05 |
| IUPAC Name | [(2R,3R,4R,5R)-2-(6-aminopurin-9-yl)-5-[[[dihydroxyphosphinothioyloxy(hydroxy)phosphoryl]oxy-hydroxyphosphoryl]oxymethyl]-4-hydroxyoxolan-3-yl] 4-benzylbenzoate |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)OP(=O)(O)OP(O)(O)=S)[C@@H](O)[C@H]1OC(=O)c1ccc(Cc2ccccc2)cc1 |
| InChI | InChI=1S/C24H26N5O13P3S/c25-21-18-22(27-12-26-21)29(13-28-18)23-20(40-24(31)16-8-6-15(7-9-16)10-14-4-2-1-3-5-14)19(30)17(39-23)11-38-43(32,33)41-44(34,35)42-45(36,37)46/h1-9,12-13,17,19-20,23,30H,10-11H2,(H,32,33)(H,34,35)(H2,25,26,27)(H2,36,37,46)/t17-,19-,20-,23-/m1/s1 |
| InChIKey | BEZRLHQSORYETC-ZDXOVATRSA-N |
| XLogP | 1.94 |
| TPSA | 268.13 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.48 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|