C19H21N5O10P2S — CID 11678624
[(2R,3R,4R,5R)-2-(6-aminopurin-9-yl)-5-[[dihydroxyphosphinothioyloxy(hydroxy)phosphoryl]oxymethyl]-4-hydroxyoxolan-3-yl] (E)-3-phenylprop-2-enoate (PubChem CID 11678624) has the molecular formula C19H21N5O10P2S and a molecular weight of 573.42 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-2-(6-aminopurin-9-yl)-5-[[dihydroxyphosphinothioyloxy(hydroxy)phosphoryl]oxymethyl]-4-hydroxyoxolan-3-yl] (E)-3-phenylprop-2-enoate.
| Compound Name | [(2R,3R,4R,5R)-2-(6-aminopurin-9-yl)-5-[[dihydroxyphosphinothioyloxy(hydroxy)phosphoryl]oxymethyl]-4-hydroxyoxolan-3-yl] (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 11678624 |
| Molecular Formula | C19H21N5O10P2S |
| Molecular Weight | 573.42 g/mol |
| Exact Mass | 573.05 |
| IUPAC Name | [(2R,3R,4R,5R)-2-(6-aminopurin-9-yl)-5-[[dihydroxyphosphinothioyloxy(hydroxy)phosphoryl]oxymethyl]-4-hydroxyoxolan-3-yl] (E)-3-phenylprop-2-enoate |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)OP(O)(O)=S)[C@@H](O)[C@H]1OC(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C19H21N5O10P2S/c20-17-14-18(22-9-21-17)24(10-23-14)19-16(33-13(25)7-6-11-4-2-1-3-5-11)15(26)12(32-19)8-31-35(27,28)34-36(29,30)37/h1-7,9-10,12,15-16,19,26H,8H2,(H,27,28)(H2,20,21,22)(H2,29,30,37)/b7-6+/t12-,15-,16-,19-/m1/s1 |
| InChIKey | FKKYTRLJIRZONF-VFIQZALSSA-N |
| XLogP | 0.63 |
| TPSA | 221.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.42 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|