C23H32N6O5 — CID 67863004
[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl benzoate;N,N-diethylethanamine (PubChem CID 67863004) has the molecular formula C23H32N6O5 and a molecular weight of 472.55 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl benzoate;N,N-diethylethanamine.
| Compound Name | [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl benzoate;N,N-diethylethanamine |
|---|---|
| PubChem CID | 67863004 |
| Molecular Formula | C23H32N6O5 |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.24 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl benzoate;N,N-diethylethanamine |
| SMILES | CCN(CC)CC.Nc1ncnc2c1ncn2[C@@H]1O[C@H](COC(=O)c2ccccc2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C17H17N5O5.C6H15N/c18-14-11-15(20-7-19-14)22(8-21-11)16-13(24)12(23)10(27-16)6-26-17(25)9-4-2-1-3-5-9;1-4-7(5-2)6-3/h1-5,7-8,10,12-13,16,23-24H,6H2,(H2,18,19,20);4-6H2,1-3H3/t10-,12-,13-,16-;/m1./s1 |
| InChIKey | RDAQTABWLGWOCP-KHXPSBENSA-N |
| XLogP | 1.23 |
| TPSA | 148.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |