C23H34N7O9P — CID 24332
[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate;2-(diethylamino)ethyl 4-aminobenzoate (PubChem CID 24332) has the molecular formula C23H34N7O9P and a molecular weight of 583.54 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate;2-(diethylamino)ethyl 4-aminobenzoate.
| Compound Name | [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate;2-(diethylamino)ethyl 4-aminobenzoate |
|---|---|
| PubChem CID | 24332 |
| Molecular Formula | C23H34N7O9P |
| Molecular Weight | 583.54 g/mol |
| Exact Mass | 583.22 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate;2-(diethylamino)ethyl 4-aminobenzoate |
| SMILES | CCN(CC)CCOC(=O)c1ccc(N)cc1.Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C13H20N2O2.C10H14N5O7P/c1-3-15(4-2)9-10-17-13(16)11-5-7-12(14)8-6-11;11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(22-10)1-21-23(18,19)20/h5-8H,3-4,9-10,14H2,1-2H3;2-4,6-7,10,16-17H,1H2,(H2,11,12,13)(H2,18,19,20)/t;4-,6-,7-,10-/m.1/s1 |
| InChIKey | MOXPAJFQYXNAJL-LPEHXXKESA-N |
| XLogP | -0.10 |
| TPSA | 241.63 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.54 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|