C19H23N7O6 — CID 160843986
[(2R,4S,5R)-3,4-dihydroxy-5-[6-[(4-hydroxyphenyl)methylamino]purin-9-yl]oxolan-2-yl]methyl N-(aminomethyl)carbamate (PubChem CID 160843986) has the molecular formula C19H23N7O6 and a molecular weight of 445.44 g/mol. Its IUPAC name is [(2R,4S,5R)-3,4-dihydroxy-5-[6-[(4-hydroxyphenyl)methylamino]purin-9-yl]oxolan-2-yl]methyl N-(aminomethyl)carbamate.
| Compound Name | [(2R,4S,5R)-3,4-dihydroxy-5-[6-[(4-hydroxyphenyl)methylamino]purin-9-yl]oxolan-2-yl]methyl N-(aminomethyl)carbamate |
|---|---|
| PubChem CID | 160843986 |
| Molecular Formula | C19H23N7O6 |
| Molecular Weight | 445.44 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | [(2R,4S,5R)-3,4-dihydroxy-5-[6-[(4-hydroxyphenyl)methylamino]purin-9-yl]oxolan-2-yl]methyl N-(aminomethyl)carbamate |
| SMILES | NCNC(=O)OC[C@H]1O[C@@H](n2cnc3c(NCc4ccc(O)cc4)ncnc32)[C@@H](O)C1O |
| InChI | InChI=1S/C19H23N7O6/c20-7-22-19(30)31-6-12-14(28)15(29)18(32-12)26-9-25-13-16(23-8-24-17(13)26)21-5-10-1-3-11(27)4-2-10/h1-4,8-9,12,14-15,18,27-29H,5-7,20H2,(H,22,30)(H,21,23,24)/t12-,14?,15+,18-/m1/s1 |
| InChIKey | SIJZMGRPQNGEAW-OWYXCUOISA-N |
| XLogP | -0.59 |
| TPSA | 189.90 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.44 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|