C17H21N6O5P — CID 54448047
[(2R,3S,4R,5R)-5-[6-(benzylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxyphosphonamidous acid (PubChem CID 54448047) has the molecular formula C17H21N6O5P and a molecular weight of 420.37 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-[6-(benzylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxyphosphonamidous acid.
| Compound Name | [(2R,3S,4R,5R)-5-[6-(benzylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxyphosphonamidous acid |
|---|---|
| PubChem CID | 54448047 |
| Molecular Formula | C17H21N6O5P |
| Molecular Weight | 420.37 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | [(2R,3S,4R,5R)-5-[6-(benzylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxyphosphonamidous acid |
| SMILES | NP(O)OC[C@H]1O[C@@H](n2cnc3c(NCc4ccccc4)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C17H21N6O5P/c18-29(26)27-7-11-13(24)14(25)17(28-11)23-9-22-12-15(20-8-21-16(12)23)19-6-10-4-2-1-3-5-10/h1-5,8-9,11,13-14,17,24-26H,6-7,18H2,(H,19,20,21)/t11-,13-,14-,17-,29?/m1/s1 |
| InChIKey | WSYFLJXLPMADFW-WJTMPRQCSA-N |
| XLogP | 0.25 |
| TPSA | 160.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.37 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|