C17H20N5O6PS — CID 164787754
(2R,4R,5R)-2-[6-(benzylamino)purin-9-yl]-5-(dihydroxyphosphinothioyloxymethyl)oxolane-3,4-diol (PubChem CID 164787754) has the molecular formula C17H20N5O6PS and a molecular weight of 453.42 g/mol. Its IUPAC name is (2R,4R,5R)-2-[6-(benzylamino)purin-9-yl]-5-(dihydroxyphosphinothioyloxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,4R,5R)-2-[6-(benzylamino)purin-9-yl]-5-(dihydroxyphosphinothioyloxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 164787754 |
| Molecular Formula | C17H20N5O6PS |
| Molecular Weight | 453.42 g/mol |
| Exact Mass | 453.09 |
| IUPAC Name | (2R,4R,5R)-2-[6-(benzylamino)purin-9-yl]-5-(dihydroxyphosphinothioyloxymethyl)oxolane-3,4-diol |
| SMILES | OC1[C@@H](O)[C@@H](COP(O)(O)=S)O[C@H]1n1cnc2c(NCc3ccccc3)ncnc21 |
| InChI | InChI=1S/C17H20N5O6PS/c23-13-11(7-27-29(25,26)30)28-17(14(13)24)22-9-21-12-15(19-8-20-16(12)22)18-6-10-4-2-1-3-5-10/h1-5,8-9,11,13-14,17,23-24H,6-7H2,(H,18,19,20)(H2,25,26,30)/t11-,13+,14?,17-/m1/s1 |
| InChIKey | SZCAIHBBPYNPKS-NUKIEUHSSA-N |
| XLogP | 0.28 |
| TPSA | 155.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.42 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|