C18H22N5O8PS — CID 172764224
[[(2S,3S,4R,5R)-5-[6-(benzylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]-methylsulfonylmethyl]phosphonic acid (PubChem CID 172764224) has the molecular formula C18H22N5O8PS and a molecular weight of 499.44 g/mol. Its IUPAC name is [[(2S,3S,4R,5R)-5-[6-(benzylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]-methylsulfonylmethyl]phosphonic acid.
| Compound Name | [[(2S,3S,4R,5R)-5-[6-(benzylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]-methylsulfonylmethyl]phosphonic acid |
|---|---|
| PubChem CID | 172764224 |
| Molecular Formula | C18H22N5O8PS |
| Molecular Weight | 499.44 g/mol |
| Exact Mass | 499.09 |
| IUPAC Name | [[(2S,3S,4R,5R)-5-[6-(benzylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]-methylsulfonylmethyl]phosphonic acid |
| SMILES | CS(=O)(=O)C([C@H]1O[C@@H](n2cnc3c(NCc4ccccc4)ncnc32)[C@H](O)[C@@H]1O)P(=O)(O)O |
| InChI | InChI=1S/C18H22N5O8PS/c1-33(29,30)18(32(26,27)28)14-12(24)13(25)17(31-14)23-9-22-11-15(20-8-21-16(11)23)19-7-10-5-3-2-4-6-10/h2-6,8-9,12-14,17-18,24-25H,7H2,1H3,(H,19,20,21)(H2,26,27,28)/t12-,13+,14-,17+,18?/m0/s1 |
| InChIKey | MCCUPJNNVACNEK-JSRCKDDZSA-N |
| XLogP | -0.39 |
| TPSA | 196.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.44 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|