C24H26N5O8PS — CID 162470663
[[(2S,3S,5R)-5-[6-(benzylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfonyl-phenylmethyl]phosphonic acid (PubChem CID 162470663) has the molecular formula C24H26N5O8PS and a molecular weight of 575.54 g/mol. Its IUPAC name is [[(2S,3S,5R)-5-[6-(benzylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfonyl-phenylmethyl]phosphonic acid.
| Compound Name | [[(2S,3S,5R)-5-[6-(benzylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfonyl-phenylmethyl]phosphonic acid |
|---|---|
| PubChem CID | 162470663 |
| Molecular Formula | C24H26N5O8PS |
| Molecular Weight | 575.54 g/mol |
| Exact Mass | 575.12 |
| IUPAC Name | [[(2S,3S,5R)-5-[6-(benzylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfonyl-phenylmethyl]phosphonic acid |
| SMILES | O=P(O)(O)C(c1ccccc1)S(=O)(=O)C[C@H]1O[C@@H](n2cnc3c(NCc4ccccc4)ncnc32)C(O)[C@@H]1O |
| InChI | InChI=1S/C24H26N5O8PS/c30-19-17(12-39(35,36)24(38(32,33)34)16-9-5-2-6-10-16)37-23(20(19)31)29-14-28-18-21(26-13-27-22(18)29)25-11-15-7-3-1-4-8-15/h1-10,13-14,17,19-20,23-24,30-31H,11-12H2,(H,25,26,27)(H2,32,33,34)/t17-,19-,20?,23-,24?/m1/s1 |
| InChIKey | QPNYWJHFZNDRBU-IFJBIGCVSA-N |
| XLogP | 1.35 |
| TPSA | 196.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.54 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|