C25H28N6O5S — CID 58296187
2-[(2R,3S,4R,5R)-5-[6-(2,2-diphenylethylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]ethanesulfonamide (PubChem CID 58296187) has the molecular formula C25H28N6O5S and a molecular weight of 524.60 g/mol. Its IUPAC name is 2-[(2R,3S,4R,5R)-5-[6-(2,2-diphenylethylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]ethanesulfonamide.
| Compound Name | 2-[(2R,3S,4R,5R)-5-[6-(2,2-diphenylethylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]ethanesulfonamide |
|---|---|
| PubChem CID | 58296187 |
| Molecular Formula | C25H28N6O5S |
| Molecular Weight | 524.60 g/mol |
| Exact Mass | 524.18 |
| IUPAC Name | 2-[(2R,3S,4R,5R)-5-[6-(2,2-diphenylethylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]ethanesulfonamide |
| SMILES | NS(=O)(=O)CC[C@H]1O[C@@H](n2cnc3c(NCC(c4ccccc4)c4ccccc4)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C25H28N6O5S/c26-37(34,35)12-11-19-21(32)22(33)25(36-19)31-15-30-20-23(28-14-29-24(20)31)27-13-18(16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1-10,14-15,18-19,21-22,25,32-33H,11-13H2,(H2,26,34,35)(H,27,28,29)/t19-,21-,22-,25-/m1/s1 |
| InChIKey | HHHOWXVPPSUFKF-PTGPVQHPSA-N |
| XLogP | 1.37 |
| TPSA | 165.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.60 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |