C24H23N7O8 — CID 88650445
(2R,5R)-2-[6-[2,2-bis(4-nitrophenyl)ethylamino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 88650445) has the molecular formula C24H23N7O8 and a molecular weight of 537.49 g/mol. Its IUPAC name is (2R,5R)-2-[6-[2,2-bis(4-nitrophenyl)ethylamino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,5R)-2-[6-[2,2-bis(4-nitrophenyl)ethylamino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 88650445 |
| Molecular Formula | C24H23N7O8 |
| Molecular Weight | 537.49 g/mol |
| Exact Mass | 537.16 |
| IUPAC Name | (2R,5R)-2-[6-[2,2-bis(4-nitrophenyl)ethylamino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | O=[N+]([O-])c1ccc(C(CNc2ncnc3c2ncn3[C@@H]2O[C@H](CO)C(O)C2O)c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C24H23N7O8/c32-10-18-20(33)21(34)24(39-18)29-12-28-19-22(26-11-27-23(19)29)25-9-17(13-1-5-15(6-2-13)30(35)36)14-3-7-16(8-4-14)31(37)38/h1-8,11-12,17-18,20-21,24,32-34H,9-10H2,(H,25,26,27)/t18-,20?,21?,24-/m1/s1 |
| InChIKey | ZBQSZUBXSAVOTN-LBQDIGMFSA-N |
| XLogP | 1.50 |
| TPSA | 211.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.49 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|