C14H18N5O6- — CID 7072007
4-[[9-[(2S,3R,4S,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]amino]butanoate (PubChem CID 7072007) has the molecular formula C14H18N5O6- and a molecular weight of 352.33 g/mol. Its IUPAC name is 4-[[9-[(2S,3R,4S,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]amino]butanoate.
| Compound Name | 4-[[9-[(2S,3R,4S,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]amino]butanoate |
|---|---|
| PubChem CID | 7072007 |
| Molecular Formula | C14H18N5O6- |
| Molecular Weight | 352.33 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | 4-[[9-[(2S,3R,4S,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]amino]butanoate |
| SMILES | O=C([O-])CCCNc1ncnc2c1ncn2[C@H]1O[C@@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C14H19N5O6/c20-4-7-10(23)11(24)14(25-7)19-6-18-9-12(16-5-17-13(9)19)15-3-1-2-8(21)22/h5-7,10-11,14,20,23-24H,1-4H2,(H,21,22)(H,15,16,17)/p-1/t7-,10+,11+,14-/m0/s1 |
| InChIKey | YGWCKRAJGQHFGB-ZURSNBDQSA-M |
| XLogP | -2.62 |
| TPSA | 165.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.33 |
| LogP ≤ 5 | -2.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|