C14H19N5O6 — CID 6561295
4-[[9-[(2R,3R,4S,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]amino]butanoic acid (PubChem CID 6561295) has the molecular formula C14H19N5O6 and a molecular weight of 353.34 g/mol. Its IUPAC name is 4-[[9-[(2R,3R,4S,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]amino]butanoic acid.
| Compound Name | 4-[[9-[(2R,3R,4S,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]amino]butanoic acid |
|---|---|
| PubChem CID | 6561295 |
| Molecular Formula | C14H19N5O6 |
| Molecular Weight | 353.34 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | 4-[[9-[(2R,3R,4S,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]amino]butanoic acid |
| SMILES | O=C(O)CCCNc1ncnc2c1ncn2[C@@H]1O[C@@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C14H19N5O6/c20-4-7-10(23)11(24)14(25-7)19-6-18-9-12(16-5-17-13(9)19)15-3-1-2-8(21)22/h5-7,10-11,14,20,23-24H,1-4H2,(H,21,22)(H,15,16,17)/t7-,10+,11+,14+/m0/s1 |
| InChIKey | YGWCKRAJGQHFGB-OAIMEQBNSA-N |
| XLogP | -1.29 |
| TPSA | 162.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.34 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|