C17H25N5O5S — CID 164771340
6-[[9-[(2R,5S)-3,4-dihydroxy-5-(methylsulfanylmethyl)oxolan-2-yl]purin-6-yl]amino]hexanoic acid (PubChem CID 164771340) has the molecular formula C17H25N5O5S and a molecular weight of 411.48 g/mol. Its IUPAC name is 6-[[9-[(2R,5S)-3,4-dihydroxy-5-(methylsulfanylmethyl)oxolan-2-yl]purin-6-yl]amino]hexanoic acid.
| Compound Name | 6-[[9-[(2R,5S)-3,4-dihydroxy-5-(methylsulfanylmethyl)oxolan-2-yl]purin-6-yl]amino]hexanoic acid |
|---|---|
| PubChem CID | 164771340 |
| Molecular Formula | C17H25N5O5S |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | 6-[[9-[(2R,5S)-3,4-dihydroxy-5-(methylsulfanylmethyl)oxolan-2-yl]purin-6-yl]amino]hexanoic acid |
| SMILES | CSC[C@H]1O[C@@H](n2cnc3c(NCCCCCC(=O)O)ncnc32)C(O)C1O |
| InChI | InChI=1S/C17H25N5O5S/c1-28-7-10-13(25)14(26)17(27-10)22-9-21-12-15(19-8-20-16(12)22)18-6-4-2-3-5-11(23)24/h8-10,13-14,17,25-26H,2-7H2,1H3,(H,23,24)(H,18,19,20)/t10-,13?,14?,17-/m1/s1 |
| InChIKey | BGQIXPXEWYONKB-PLXTWVAHSA-N |
| XLogP | 0.87 |
| TPSA | 142.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|