C18H28N6O5S — CID 59738112
2-amino-4-[[5-[6-(butylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfanyl]butanoic acid (PubChem CID 59738112) has the molecular formula C18H28N6O5S and a molecular weight of 440.53 g/mol. Its IUPAC name is 2-amino-4-[[5-[6-(butylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfanyl]butanoic acid.
| Compound Name | 2-amino-4-[[5-[6-(butylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfanyl]butanoic acid |
|---|---|
| PubChem CID | 59738112 |
| Molecular Formula | C18H28N6O5S |
| Molecular Weight | 440.53 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | 2-amino-4-[[5-[6-(butylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfanyl]butanoic acid |
| SMILES | CCCCNc1ncnc2c1ncn2C1OC(CSCCC(N)C(=O)O)C(O)C1O |
| InChI | InChI=1S/C18H28N6O5S/c1-2-3-5-20-15-12-16(22-8-21-15)24(9-23-12)17-14(26)13(25)11(29-17)7-30-6-4-10(19)18(27)28/h8-11,13-14,17,25-26H,2-7,19H2,1H3,(H,27,28)(H,20,21,22) |
| InChIKey | LRLGTRVNQMXETN-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 168.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.53 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|