C18H29N7O5S — CID 69295593
2-amino-4-[[(2S,3S,4R,5R)-5-[6-[2-(dimethylamino)ethylamino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfanyl]butanoic acid (PubChem CID 69295593) has the molecular formula C18H29N7O5S and a molecular weight of 455.54 g/mol. Its IUPAC name is 2-amino-4-[[(2S,3S,4R,5R)-5-[6-[2-(dimethylamino)ethylamino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfanyl]butanoic acid.
| Compound Name | 2-amino-4-[[(2S,3S,4R,5R)-5-[6-[2-(dimethylamino)ethylamino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfanyl]butanoic acid |
|---|---|
| PubChem CID | 69295593 |
| Molecular Formula | C18H29N7O5S |
| Molecular Weight | 455.54 g/mol |
| Exact Mass | 455.20 |
| IUPAC Name | 2-amino-4-[[(2S,3S,4R,5R)-5-[6-[2-(dimethylamino)ethylamino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfanyl]butanoic acid |
| SMILES | CN(C)CCNc1ncnc2c1ncn2[C@@H]1O[C@H](CSCCC(N)C(=O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C18H29N7O5S/c1-24(2)5-4-20-15-12-16(22-8-21-15)25(9-23-12)17-14(27)13(26)11(30-17)7-31-6-3-10(19)18(28)29/h8-11,13-14,17,26-27H,3-7,19H2,1-2H3,(H,28,29)(H,20,21,22)/t10?,11-,13-,14-,17-/m1/s1 |
| InChIKey | KNFHRZDJCOXFLG-QIFOKDCASA-N |
| XLogP | -1.05 |
| TPSA | 171.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.54 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|