C19H31N7O7S2 — CID 68666389
(2S)-2-amino-4-[[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methylsulfanyl]butanoic acid;(2S)-2-amino-4-methylsulfanylbutanoic acid (PubChem CID 68666389) has the molecular formula C19H31N7O7S2 and a molecular weight of 533.63 g/mol. Its IUPAC name is (2S)-2-amino-4-[[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methylsulfanyl]butanoic acid;(2S)-2-amino-4-methylsulfanylbutanoic acid.
| Compound Name | (2S)-2-amino-4-[[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methylsulfanyl]butanoic acid;(2S)-2-amino-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 68666389 |
| Molecular Formula | C19H31N7O7S2 |
| Molecular Weight | 533.63 g/mol |
| Exact Mass | 533.17 |
| IUPAC Name | (2S)-2-amino-4-[[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methylsulfanyl]butanoic acid;(2S)-2-amino-4-methylsulfanylbutanoic acid |
| SMILES | CSCC[C@H](N)C(=O)O.Nc1ncnc2c1ncn2[C@@H]1O[C@H](CSCC[C@H](N)C(=O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C14H20N6O5S.C5H11NO2S/c15-6(14(23)24)1-2-26-3-7-9(21)10(22)13(25-7)20-5-19-8-11(16)17-4-18-12(8)20;1-9-3-2-4(6)5(7)8/h4-7,9-10,13,21-22H,1-3,15H2,(H,23,24)(H2,16,17,18);4H,2-3,6H2,1H3,(H,7,8)/t6-,7+,9+,10+,13+;4-/m00/s1 |
| InChIKey | ZEZCWAIFNVLNBS-PKQAIJGQSA-N |
| XLogP | -1.29 |
| TPSA | 245.95 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.63 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|