C15H26N6O10S2 — CID 175102931
(2S)-2-amino-4-methylsulfanylbutanoic acid;(2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol;sulfuric acid (PubChem CID 175102931) has the molecular formula C15H26N6O10S2 and a molecular weight of 514.54 g/mol. Its IUPAC name is (2S)-2-amino-4-methylsulfanylbutanoic acid;(2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol;sulfuric acid.
| Compound Name | (2S)-2-amino-4-methylsulfanylbutanoic acid;(2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol;sulfuric acid |
|---|---|
| PubChem CID | 175102931 |
| Molecular Formula | C15H26N6O10S2 |
| Molecular Weight | 514.54 g/mol |
| Exact Mass | 514.12 |
| IUPAC Name | (2S)-2-amino-4-methylsulfanylbutanoic acid;(2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol;sulfuric acid |
| SMILES | CSCC[C@H](N)C(=O)O.Nc1ncnc2c1ncn2[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O.O=S(=O)(O)O |
| InChI | InChI=1S/C10H13N5O4.C5H11NO2S.H2O4S/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(18)6(17)4(1-16)19-10;1-9-3-2-4(6)5(7)8;1-5(2,3)4/h2-4,6-7,10,16-18H,1H2,(H2,11,12,13);4H,2-3,6H2,1H3,(H,7,8);(H2,1,2,3,4)/t4-,6-,7-,10-;4-;/m10./s1 |
| InChIKey | JTSMJGFTTCIHHX-CPKMBRAWSA-N |
| XLogP | -2.48 |
| TPSA | 277.46 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.54 |
| LogP ≤ 5 | -2.48 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|