C15H24N6O9S2 — CID 66753275
(2S)-2-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methylamino]-4-methylsulfanylbutanoic acid;sulfuric acid (PubChem CID 66753275) has the molecular formula C15H24N6O9S2 and a molecular weight of 496.52 g/mol. Its IUPAC name is (2S)-2-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methylamino]-4-methylsulfanylbutanoic acid;sulfuric acid.
| Compound Name | (2S)-2-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methylamino]-4-methylsulfanylbutanoic acid;sulfuric acid |
|---|---|
| PubChem CID | 66753275 |
| Molecular Formula | C15H24N6O9S2 |
| Molecular Weight | 496.52 g/mol |
| Exact Mass | 496.10 |
| IUPAC Name | (2S)-2-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methylamino]-4-methylsulfanylbutanoic acid;sulfuric acid |
| SMILES | CSCC[C@H](NC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O)C(=O)O.O=S(=O)(O)O |
| InChI | InChI=1S/C15H22N6O5S.H2O4S/c1-27-3-2-7(15(24)25)17-4-8-10(22)11(23)14(26-8)21-6-20-9-12(16)18-5-19-13(9)21;1-5(2,3)4/h5-8,10-11,14,17,22-23H,2-4H2,1H3,(H,24,25)(H2,16,18,19);(H2,1,2,3,4)/t7-,8+,10+,11+,14+;/m0./s1 |
| InChIKey | USRPVCOWNUBBNH-HXTWIPGBSA-N |
| XLogP | -1.83 |
| TPSA | 243.24 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.52 |
| LogP ≤ 5 | -1.83 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|