C17H30N7O9PS — CID 70116173
2-aminoethyl dihydrogen phosphate;(2S)-2-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methylamino]-4-methylsulfanylbutanoic acid (PubChem CID 70116173) has the molecular formula C17H30N7O9PS and a molecular weight of 539.51 g/mol. Its IUPAC name is 2-aminoethyl dihydrogen phosphate;(2S)-2-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methylamino]-4-methylsulfanylbutanoic acid.
| Compound Name | 2-aminoethyl dihydrogen phosphate;(2S)-2-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methylamino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 70116173 |
| Molecular Formula | C17H30N7O9PS |
| Molecular Weight | 539.51 g/mol |
| Exact Mass | 539.16 |
| IUPAC Name | 2-aminoethyl dihydrogen phosphate;(2S)-2-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methylamino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCC[C@H](NC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O)C(=O)O.NCCOP(=O)(O)O |
| InChI | InChI=1S/C15H22N6O5S.C2H8NO4P/c1-27-3-2-7(15(24)25)17-4-8-10(22)11(23)14(26-8)21-6-20-9-12(16)18-5-19-13(9)21;3-1-2-7-8(4,5)6/h5-8,10-11,14,17,22-23H,2-4H2,1H3,(H,24,25)(H2,16,18,19);1-3H2,(H2,4,5,6)/t7-,8+,10+,11+,14+;/m0./s1 |
| InChIKey | DSAOFBJARXTDSL-HXTWIPGBSA-N |
| XLogP | -2.12 |
| TPSA | 261.42 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.51 |
| LogP ≤ 5 | -2.12 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|