C16H28N7O9P — CID 67565211
[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate;2,6-diaminohexanoic acid (PubChem CID 67565211) has the molecular formula C16H28N7O9P and a molecular weight of 493.41 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate;2,6-diaminohexanoic acid.
| Compound Name | [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate;2,6-diaminohexanoic acid |
|---|---|
| PubChem CID | 67565211 |
| Molecular Formula | C16H28N7O9P |
| Molecular Weight | 493.41 g/mol |
| Exact Mass | 493.17 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate;2,6-diaminohexanoic acid |
| SMILES | NCCCCC(N)C(=O)O.Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C10H14N5O7P.C6H14N2O2/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(22-10)1-21-23(18,19)20;7-4-2-1-3-5(8)6(9)10/h2-4,6-7,10,16-17H,1H2,(H2,11,12,13)(H2,18,19,20);5H,1-4,7-8H2,(H,9,10)/t4-,6-,7-,10-;/m1./s1 |
| InChIKey | OYBUDIQHACZNSS-MCDZGGTQSA-N |
| XLogP | -2.34 |
| TPSA | 275.41 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.41 |
| LogP ≤ 5 | -2.34 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|