C16H23N6O10P — CID 87398744
2-amino-5-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]hexanedioic acid (PubChem CID 87398744) has the molecular formula C16H23N6O10P and a molecular weight of 490.37 g/mol. Its IUPAC name is 2-amino-5-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]hexanedioic acid.
| Compound Name | 2-amino-5-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]hexanedioic acid |
|---|---|
| PubChem CID | 87398744 |
| Molecular Formula | C16H23N6O10P |
| Molecular Weight | 490.37 g/mol |
| Exact Mass | 490.12 |
| IUPAC Name | 2-amino-5-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]hexanedioic acid |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)C(CCC(N)C(=O)O)C(=O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C16H23N6O10P/c17-6(15(25)26)1-2-8(16(27)28)33(29,30)31-3-7-10(23)11(24)14(32-7)22-5-21-9-12(18)19-4-20-13(9)22/h4-8,10-11,14,23-24H,1-3,17H2,(H,25,26)(H,27,28)(H,29,30)(H2,18,19,20)/t6?,7-,8?,10-,11-,14-/m1/s1 |
| InChIKey | DKQLJMKRTFKVTD-DGTGAXRRSA-N |
| XLogP | -2.12 |
| TPSA | 266.46 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.37 |
| LogP ≤ 5 | -2.12 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|