C15H27N6O15P3S — CID 89188589
2-amino-4-methylsulfanylbutanoic acid;[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 89188589) has the molecular formula C15H27N6O15P3S and a molecular weight of 656.40 g/mol. Its IUPAC name is 2-amino-4-methylsulfanylbutanoic acid;[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | 2-amino-4-methylsulfanylbutanoic acid;[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 89188589 |
| Molecular Formula | C15H27N6O15P3S |
| Molecular Weight | 656.40 g/mol |
| Exact Mass | 656.05 |
| IUPAC Name | 2-amino-4-methylsulfanylbutanoic acid;[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | CSCCC(N)C(=O)O.Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C10H16N5O13P3.C5H11NO2S/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(26-10)1-25-30(21,22)28-31(23,24)27-29(18,19)20;1-9-3-2-4(6)5(7)8/h2-4,6-7,10,16-17H,1H2,(H,21,22)(H,23,24)(H2,11,12,13)(H2,18,19,20);4H,2-3,6H2,1H3,(H,7,8)/t4-,6-,7-,10-;/m1./s1 |
| InChIKey | MYYMUGHGWQEFQE-MCDZGGTQSA-N |
| XLogP | -1.48 |
| TPSA | 342.45 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.40 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|