C19H30N6O10S3 — CID 118456369
(2S)-2-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-hydroxy-3-(4-sulfobutylsulfonyloxy)oxolan-2-yl]methylamino]-4-methylsulfanylbutanoic acid (PubChem CID 118456369) has the molecular formula C19H30N6O10S3 and a molecular weight of 598.68 g/mol. Its IUPAC name is (2S)-2-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-hydroxy-3-(4-sulfobutylsulfonyloxy)oxolan-2-yl]methylamino]-4-methylsulfanylbutanoic acid.
| Compound Name | (2S)-2-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-hydroxy-3-(4-sulfobutylsulfonyloxy)oxolan-2-yl]methylamino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 118456369 |
| Molecular Formula | C19H30N6O10S3 |
| Molecular Weight | 598.68 g/mol |
| Exact Mass | 598.12 |
| IUPAC Name | (2S)-2-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-hydroxy-3-(4-sulfobutylsulfonyloxy)oxolan-2-yl]methylamino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCC[C@H](NC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1OS(=O)(=O)CCCCS(=O)(=O)O)C(=O)O |
| InChI | InChI=1S/C19H30N6O10S3/c1-36-5-4-11(19(27)28)21-8-12-15(35-38(32,33)7-3-2-6-37(29,30)31)14(26)18(34-12)25-10-24-13-16(20)22-9-23-17(13)25/h9-12,14-15,18,21,26H,2-8H2,1H3,(H,27,28)(H2,20,22,23)(H,29,30,31)/t11-,12+,14+,15+,18+/m0/s1 |
| InChIKey | CWNCCAQMJJANTE-URQYDQELSA-N |
| XLogP | -1.15 |
| TPSA | 246.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.68 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|