C15H21FN6O5S — CID 150284288
(2S)-2-[[(2R,3S,4R,5R)-5-(6-amino-2-fluoropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methylamino]-4-methylsulfanylbutanoic acid (PubChem CID 150284288) has the molecular formula C15H21FN6O5S and a molecular weight of 416.44 g/mol. Its IUPAC name is (2S)-2-[[(2R,3S,4R,5R)-5-(6-amino-2-fluoropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methylamino]-4-methylsulfanylbutanoic acid.
| Compound Name | (2S)-2-[[(2R,3S,4R,5R)-5-(6-amino-2-fluoropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methylamino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 150284288 |
| Molecular Formula | C15H21FN6O5S |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | (2S)-2-[[(2R,3S,4R,5R)-5-(6-amino-2-fluoropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methylamino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCC[C@H](NC[C@H]1O[C@@H](n2cnc3c(N)nc(F)nc32)[C@H](O)[C@@H]1O)C(=O)O |
| InChI | InChI=1S/C15H21FN6O5S/c1-28-3-2-6(14(25)26)18-4-7-9(23)10(24)13(27-7)22-5-19-8-11(17)20-15(16)21-12(8)22/h5-7,9-10,13,18,23-24H,2-4H2,1H3,(H,25,26)(H2,17,20,21)/t6-,7+,9+,10+,13+/m0/s1 |
| InChIKey | GGFZRQDNKPPZST-WFMPWKQPSA-N |
| XLogP | -1.04 |
| TPSA | 168.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |