C12H16FN5O4S — CID 45269744
(2R,3R,4S,5S)-2-(6-amino-2-fluoropurin-9-yl)-5-(2-hydroxyethylsulfanylmethyl)oxolane-3,4-diol (PubChem CID 45269744) has the molecular formula C12H16FN5O4S and a molecular weight of 345.36 g/mol. Its IUPAC name is (2R,3R,4S,5S)-2-(6-amino-2-fluoropurin-9-yl)-5-(2-hydroxyethylsulfanylmethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5S)-2-(6-amino-2-fluoropurin-9-yl)-5-(2-hydroxyethylsulfanylmethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 45269744 |
| Molecular Formula | C12H16FN5O4S |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | (2R,3R,4S,5S)-2-(6-amino-2-fluoropurin-9-yl)-5-(2-hydroxyethylsulfanylmethyl)oxolane-3,4-diol |
| SMILES | Nc1nc(F)nc2c1ncn2[C@@H]1O[C@H](CSCCO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C12H16FN5O4S/c13-12-16-9(14)6-10(17-12)18(4-15-6)11-8(21)7(20)5(22-11)3-23-2-1-19/h4-5,7-8,11,19-21H,1-3H2,(H2,14,16,17)/t5-,7-,8-,11-/m1/s1 |
| InChIKey | XALZOYNPJZJVEI-IOSLPCCCSA-N |
| XLogP | -1.11 |
| TPSA | 139.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|