C10H11FN5O5P — CID 118550487
(2R,3S,4S,5R)-2-(6-amino-2-fluoropurin-9-yl)-5-(phosphorosooxymethyl)oxolane-3,4-diol (PubChem CID 118550487) has the molecular formula C10H11FN5O5P and a molecular weight of 331.20 g/mol. Its IUPAC name is (2R,3S,4S,5R)-2-(6-amino-2-fluoropurin-9-yl)-5-(phosphorosooxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3S,4S,5R)-2-(6-amino-2-fluoropurin-9-yl)-5-(phosphorosooxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 118550487 |
| Molecular Formula | C10H11FN5O5P |
| Molecular Weight | 331.20 g/mol |
| Exact Mass | 331.05 |
| IUPAC Name | (2R,3S,4S,5R)-2-(6-amino-2-fluoropurin-9-yl)-5-(phosphorosooxymethyl)oxolane-3,4-diol |
| SMILES | Nc1nc(F)nc2c1ncn2[C@@H]1O[C@H](COP=O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C10H11FN5O5P/c11-10-14-7(12)4-8(15-10)16(2-13-4)9-6(18)5(17)3(21-9)1-20-22-19/h2-3,5-6,9,17-18H,1H2,(H2,12,14,15)/t3-,5-,6+,9-/m1/s1 |
| InChIKey | DZDNMVJKQFZLDY-FJFJXFQQSA-N |
| XLogP | -0.61 |
| TPSA | 145.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.20 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|