C13H18FN6O6P — CID 166772295
[(2S,3R,4R,5R)-5-(6-amino-2-fluoropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-N-cyclopropylphosphonamidic acid (PubChem CID 166772295) has the molecular formula C13H18FN6O6P and a molecular weight of 404.30 g/mol. Its IUPAC name is [(2S,3R,4R,5R)-5-(6-amino-2-fluoropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-N-cyclopropylphosphonamidic acid.
| Compound Name | [(2S,3R,4R,5R)-5-(6-amino-2-fluoropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-N-cyclopropylphosphonamidic acid |
|---|---|
| PubChem CID | 166772295 |
| Molecular Formula | C13H18FN6O6P |
| Molecular Weight | 404.30 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | [(2S,3R,4R,5R)-5-(6-amino-2-fluoropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-N-cyclopropylphosphonamidic acid |
| SMILES | Nc1nc(F)nc2c1ncn2[C@@H]1O[C@@H](COP(=O)(O)NC2CC2)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C13H18FN6O6P/c14-13-17-10(15)7-11(18-13)20(4-16-7)12-9(22)8(21)6(26-12)3-25-27(23,24)19-5-1-2-5/h4-6,8-9,12,21-22H,1-3H2,(H2,15,17,18)(H2,19,23,24)/t6-,8-,9+,12+/m0/s1 |
| InChIKey | VYQUKPVZWMPBAH-FNQQPIMXSA-N |
| XLogP | -0.96 |
| TPSA | 177.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.30 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|