C10H18FN5O12P2 — CID 175069794
(2R,3S,4S,5R)-2-(6-amino-2-fluoropurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol;phosphoric acid (PubChem CID 175069794) has the molecular formula C10H18FN5O12P2 and a molecular weight of 481.22 g/mol. Its IUPAC name is (2R,3S,4S,5R)-2-(6-amino-2-fluoropurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol;phosphoric acid.
| Compound Name | (2R,3S,4S,5R)-2-(6-amino-2-fluoropurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol;phosphoric acid |
|---|---|
| PubChem CID | 175069794 |
| Molecular Formula | C10H18FN5O12P2 |
| Molecular Weight | 481.22 g/mol |
| Exact Mass | 481.04 |
| IUPAC Name | (2R,3S,4S,5R)-2-(6-amino-2-fluoropurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol;phosphoric acid |
| SMILES | Nc1nc(F)nc2c1ncn2[C@@H]1O[C@H](CO)[C@@H](O)[C@@H]1O.O=P(O)(O)O.O=P(O)(O)O |
| InChI | InChI=1S/C10H12FN5O4.2H3O4P/c11-10-14-7(12)4-8(15-10)16(2-13-4)9-6(19)5(18)3(1-17)20-9;2*1-5(2,3)4/h2-3,5-6,9,17-19H,1H2,(H2,12,14,15);2*(H3,1,2,3,4)/t3-,5-,6+,9-;;/m1../s1 |
| InChIKey | QJIVBWNAMDSTAY-KKNRVDJNSA-N |
| XLogP | -3.70 |
| TPSA | 295.06 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.22 |
| LogP ≤ 5 | -3.70 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|