C11H18N5O8P — CID 172852038
(2R,3R,4S,5R)-2-(6-amino-2-methylpurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol;phosphoric acid (PubChem CID 172852038) has the molecular formula C11H18N5O8P and a molecular weight of 379.27 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(6-amino-2-methylpurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol;phosphoric acid.
| Compound Name | (2R,3R,4S,5R)-2-(6-amino-2-methylpurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol;phosphoric acid |
|---|---|
| PubChem CID | 172852038 |
| Molecular Formula | C11H18N5O8P |
| Molecular Weight | 379.27 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | (2R,3R,4S,5R)-2-(6-amino-2-methylpurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol;phosphoric acid |
| SMILES | Cc1nc(N)c2ncn([C@@H]3O[C@H](CO)[C@@H](O)[C@H]3O)c2n1.O=P(O)(O)O |
| InChI | InChI=1S/C11H15N5O4.H3O4P/c1-4-14-9(12)6-10(15-4)16(3-13-6)11-8(19)7(18)5(2-17)20-11;1-5(2,3)4/h3,5,7-8,11,17-19H,2H2,1H3,(H2,12,14,15);(H3,1,2,3,4)/t5-,7-,8-,11-;/m1./s1 |
| InChIKey | YEVGHRHZSXXQGX-YCSZXMBFSA-N |
| XLogP | -2.60 |
| TPSA | 217.30 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.27 |
| LogP ≤ 5 | -2.60 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|