C10H15N7O4 — CID 57128578
(2R,5R)-2-(6-amino-2-hydrazinylpurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 57128578) has the molecular formula C10H15N7O4 and a molecular weight of 297.28 g/mol. Its IUPAC name is (2R,5R)-2-(6-amino-2-hydrazinylpurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,5R)-2-(6-amino-2-hydrazinylpurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 57128578 |
| Molecular Formula | C10H15N7O4 |
| Molecular Weight | 297.28 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | (2R,5R)-2-(6-amino-2-hydrazinylpurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | NNc1nc(N)c2ncn([C@@H]3O[C@H](CO)C(O)C3O)c2n1 |
| InChI | InChI=1S/C10H15N7O4/c11-7-4-8(15-10(14-7)16-12)17(2-13-4)9-6(20)5(19)3(1-18)21-9/h2-3,5-6,9,18-20H,1,12H2,(H3,11,14,15,16)/t3-,5?,6?,9-/m1/s1 |
| InChIKey | BAYFDGKAUSOEIS-VKJDSPIKSA-N |
| XLogP | -2.69 |
| TPSA | 177.59 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.28 |
| LogP ≤ 5 | -2.69 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|