C13H21N7O4 — CID 10617043
(2R,3R,4S,5R)-2-[6-amino-2-(3-aminopropylamino)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 10617043) has the molecular formula C13H21N7O4 and a molecular weight of 339.36 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[6-amino-2-(3-aminopropylamino)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-[6-amino-2-(3-aminopropylamino)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 10617043 |
| Molecular Formula | C13H21N7O4 |
| Molecular Weight | 339.36 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | (2R,3R,4S,5R)-2-[6-amino-2-(3-aminopropylamino)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | NCCCNc1nc(N)c2ncn([C@@H]3O[C@H](CO)[C@@H](O)[C@H]3O)c2n1 |
| InChI | InChI=1S/C13H21N7O4/c14-2-1-3-16-13-18-10(15)7-11(19-13)20(5-17-7)12-9(23)8(22)6(4-21)24-12/h5-6,8-9,12,21-23H,1-4,14H2,(H3,15,16,18,19)/t6-,8-,9-,12-/m1/s1 |
| InChIKey | OTAWBSJWRZRKQV-WOUKDFQISA-N |
| XLogP | -2.22 |
| TPSA | 177.59 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.36 |
| LogP ≤ 5 | -2.22 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|