C15H25N7O4 — CID 10690318
(2R,3R,4S,5R)-2-[6-amino-2-(5-aminopentylamino)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 10690318) has the molecular formula C15H25N7O4 and a molecular weight of 367.41 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[6-amino-2-(5-aminopentylamino)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-[6-amino-2-(5-aminopentylamino)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 10690318 |
| Molecular Formula | C15H25N7O4 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | (2R,3R,4S,5R)-2-[6-amino-2-(5-aminopentylamino)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | NCCCCCNc1nc(N)c2ncn([C@@H]3O[C@H](CO)[C@@H](O)[C@H]3O)c2n1 |
| InChI | InChI=1S/C15H25N7O4/c16-4-2-1-3-5-18-15-20-12(17)9-13(21-15)22(7-19-9)14-11(25)10(24)8(6-23)26-14/h7-8,10-11,14,23-25H,1-6,16H2,(H3,17,18,20,21)/t8-,10-,11-,14-/m1/s1 |
| InChIKey | UKJHKCXDXSBKQM-IDTAVKCVSA-N |
| XLogP | -1.44 |
| TPSA | 177.59 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|