C13H20N6O5 — CID 46876513
(3R,4S,5R)-2-[6-amino-2-(3-hydroxypropylamino)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 46876513) has the molecular formula C13H20N6O5 and a molecular weight of 340.34 g/mol. Its IUPAC name is (3R,4S,5R)-2-[6-amino-2-(3-hydroxypropylamino)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (3R,4S,5R)-2-[6-amino-2-(3-hydroxypropylamino)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 46876513 |
| Molecular Formula | C13H20N6O5 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | (3R,4S,5R)-2-[6-amino-2-(3-hydroxypropylamino)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | Nc1nc(NCCCO)nc2c1ncn2C1O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C13H20N6O5/c14-10-7-11(18-13(17-10)15-2-1-3-20)19(5-16-7)12-9(23)8(22)6(4-21)24-12/h5-6,8-9,12,20-23H,1-4H2,(H3,14,15,17,18)/t6-,8-,9-,12?/m1/s1 |
| InChIKey | KNHSKYRXIDYNHP-PUXKXDTASA-N |
| XLogP | -2.19 |
| TPSA | 171.80 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | -2.19 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|