C13H19N7O4 — CID 46876626
(3R,4S,5R)-2-[6-amino-2-(2-propan-2-ylidenehydrazinyl)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 46876626) has the molecular formula C13H19N7O4 and a molecular weight of 337.34 g/mol. Its IUPAC name is (3R,4S,5R)-2-[6-amino-2-(2-propan-2-ylidenehydrazinyl)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (3R,4S,5R)-2-[6-amino-2-(2-propan-2-ylidenehydrazinyl)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 46876626 |
| Molecular Formula | C13H19N7O4 |
| Molecular Weight | 337.34 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | (3R,4S,5R)-2-[6-amino-2-(2-propan-2-ylidenehydrazinyl)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | CC(C)=NNc1nc(N)c2ncn(C3O[C@H](CO)[C@@H](O)[C@H]3O)c2n1 |
| InChI | InChI=1S/C13H19N7O4/c1-5(2)18-19-13-16-10(14)7-11(17-13)20(4-15-7)12-9(23)8(22)6(3-21)24-12/h4,6,8-9,12,21-23H,3H2,1-2H3,(H3,14,16,17,19)/t6-,8-,9-,12?/m1/s1 |
| InChIKey | ROZXUSPCGRZYRJ-PUXKXDTASA-N |
| XLogP | -1.17 |
| TPSA | 163.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.34 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|