C15H23N7O4 — CID 11726345
(2R,3R,4S,5R)-2-[6-amino-2-[(2E)-2-pentylidenehydrazinyl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 11726345) has the molecular formula C15H23N7O4 and a molecular weight of 365.39 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[6-amino-2-[(2E)-2-pentylidenehydrazinyl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-[6-amino-2-[(2E)-2-pentylidenehydrazinyl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 11726345 |
| Molecular Formula | C15H23N7O4 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | (2R,3R,4S,5R)-2-[6-amino-2-[(2E)-2-pentylidenehydrazinyl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | CCCC/C=N/Nc1nc(N)c2ncn([C@@H]3O[C@H](CO)[C@@H](O)[C@H]3O)c2n1 |
| InChI | InChI=1S/C15H23N7O4/c1-2-3-4-5-18-21-15-19-12(16)9-13(20-15)22(7-17-9)14-11(25)10(24)8(6-23)26-14/h5,7-8,10-11,14,23-25H,2-4,6H2,1H3,(H3,16,19,20,21)/b18-5+/t8-,10-,11-,14-/m1/s1 |
| InChIKey | XUGUNBSDVQONTG-MWVSPYMXSA-N |
| XLogP | -0.39 |
| TPSA | 163.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|