C10H12FN5O4 — CID 154716223
2-(6-amino-2-(18F)fluoropurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 154716223) has the molecular formula C10H12FN5O4 and a molecular weight of 284.24 g/mol. Its IUPAC name is 2-(6-amino-2-(18F)fluoropurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | 2-(6-amino-2-(18F)fluoropurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 154716223 |
| Molecular Formula | C10H12FN5O4 |
| Molecular Weight | 284.24 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | 2-(6-amino-2-(18F)fluoropurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | Nc1nc([18F])nc2c1ncn2C1OC(CO)C(O)C1O |
| InChI | InChI=1S/C10H12FN5O4/c11-10-14-7(12)4-8(15-10)16(2-13-4)9-6(19)5(18)3(1-17)20-9/h2-3,5-6,9,17-19H,1H2,(H2,12,14,15)/i11-1 |
| InChIKey | HBUBKKRHXORPQB-KXMUYVCJSA-N |
| XLogP | -1.84 |
| TPSA | 139.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.24 |
| LogP ≤ 5 | -1.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |