C14H21FN6O6S — CID 174676571
(2R,3R,4S,5R)-2-(6-amino-2-fluoropurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol;(2S)-2-amino-4-sulfanylbutanoic acid (PubChem CID 174676571) has the molecular formula C14H21FN6O6S and a molecular weight of 420.42 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(6-amino-2-fluoropurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol;(2S)-2-amino-4-sulfanylbutanoic acid.
| Compound Name | (2R,3R,4S,5R)-2-(6-amino-2-fluoropurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol;(2S)-2-amino-4-sulfanylbutanoic acid |
|---|---|
| PubChem CID | 174676571 |
| Molecular Formula | C14H21FN6O6S |
| Molecular Weight | 420.42 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | (2R,3R,4S,5R)-2-(6-amino-2-fluoropurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol;(2S)-2-amino-4-sulfanylbutanoic acid |
| SMILES | N[C@@H](CCS)C(=O)O.Nc1nc(F)nc2c1ncn2[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C10H12FN5O4.C4H9NO2S/c11-10-14-7(12)4-8(15-10)16(2-13-4)9-6(19)5(18)3(1-17)20-9;5-3(1-2-8)4(6)7/h2-3,5-6,9,17-19H,1H2,(H2,12,14,15);3,8H,1-2,5H2,(H,6,7)/t3-,5-,6-,9-;3-/m10/s1 |
| InChIKey | DANXDZRFRPFMCU-LJUUHSMOSA-N |
| XLogP | -2.12 |
| TPSA | 202.86 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.42 |
| LogP ≤ 5 | -2.12 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|