C15H24N6O6Se2 — CID 174755300
CID 174755300 (PubChem CID 174755300) has the molecular formula C15H24N6O6Se2 and a molecular weight of 542.31 g/mol.
| Compound Name | CID 174755300 |
|---|---|
| PubChem CID | 174755300 |
| Molecular Formula | C15H24N6O6Se2 |
| Molecular Weight | 542.31 g/mol |
| Exact Mass | 544.01 |
| IUPAC Name | — |
| SMILES | C[Se]CCC(N)C(=O)O.Nc1ncnc2c1ncn2[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O.[Se] |
| InChI | InChI=1S/C10H13N5O4.C5H11NO2Se.Se/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(18)6(17)4(1-16)19-10;1-9-3-2-4(6)5(7)8;/h2-4,6-7,10,16-18H,1H2,(H2,11,12,13);4H,2-3,6H2,1H3,(H,7,8);/t4-,6-,7-,10-;;/m1../s1 |
| InChIKey | CSUUCUKRRVPAOQ-IDIVVRGQSA-N |
| XLogP | -2.40 |
| TPSA | 202.86 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.31 |
| LogP ≤ 5 | -2.40 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|