C14H20N6O5Se — CID 140702015
(2R)-2-amino-4-[[(2S,4S,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methylselanyl]butanoic acid (PubChem CID 140702015) has the molecular formula C14H20N6O5Se and a molecular weight of 431.31 g/mol. Its IUPAC name is (2R)-2-amino-4-[[(2S,4S,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methylselanyl]butanoic acid.
| Compound Name | (2R)-2-amino-4-[[(2S,4S,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methylselanyl]butanoic acid |
|---|---|
| PubChem CID | 140702015 |
| Molecular Formula | C14H20N6O5Se |
| Molecular Weight | 431.31 g/mol |
| Exact Mass | 432.07 |
| IUPAC Name | (2R)-2-amino-4-[[(2S,4S,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methylselanyl]butanoic acid |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](C[Se]CC[C@@H](N)C(=O)O)C(O)[C@@H]1O |
| InChI | InChI=1S/C14H20N6O5Se/c15-6(14(23)24)1-2-26-3-7-9(21)10(22)13(25-7)20-5-19-8-11(16)17-4-18-12(8)20/h4-7,9-10,13,21-22H,1-3,15H2,(H,23,24)(H2,16,17,18)/t6-,7-,9?,10+,13-/m1/s1 |
| InChIKey | UVSMMLABJBJNGH-VGPGYCSSSA-N |
| XLogP | -1.63 |
| TPSA | 182.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.31 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|