C18H25N6O5S+ — CID 87367010
[(3S)-3-amino-3-carboxypropyl]-[[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]-but-2-ynylsulfanium (PubChem CID 87367010) has the molecular formula C18H25N6O5S+ and a molecular weight of 437.50 g/mol. Its IUPAC name is [(3S)-3-amino-3-carboxypropyl]-[[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]-but-2-ynylsulfanium.
| Compound Name | [(3S)-3-amino-3-carboxypropyl]-[[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]-but-2-ynylsulfanium |
|---|---|
| PubChem CID | 87367010 |
| Molecular Formula | C18H25N6O5S+ |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | [(3S)-3-amino-3-carboxypropyl]-[[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]-but-2-ynylsulfanium |
| SMILES | CC#CC[S+](CC[C@H](N)C(=O)O)C[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H24N6O5S/c1-2-3-5-30(6-4-10(19)18(27)28)7-11-13(25)14(26)17(29-11)24-9-23-12-15(20)21-8-22-16(12)24/h8-11,13-14,17,25-26H,4-7,19H2,1H3,(H2-,20,21,22,27,28)/p+1/t10-,11+,13+,14+,17+,30?/m0/s1 |
| InChIKey | FYSSPXIGESSXOC-NSCQNMIOSA-O |
| XLogP | -1.53 |
| TPSA | 182.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|