C19H26N9O5S+ — CID 140812800
[(2R)-2-amino-2-carboxyethyl]-[[(2S,4S,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]-(6-azidohex-2-ynyl)sulfanium (PubChem CID 140812800) has the molecular formula C19H26N9O5S+ and a molecular weight of 492.54 g/mol. Its IUPAC name is [(2R)-2-amino-2-carboxyethyl]-[[(2S,4S,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]-(6-azidohex-2-ynyl)sulfanium.
| Compound Name | [(2R)-2-amino-2-carboxyethyl]-[[(2S,4S,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]-(6-azidohex-2-ynyl)sulfanium |
|---|---|
| PubChem CID | 140812800 |
| Molecular Formula | C19H26N9O5S+ |
| Molecular Weight | 492.54 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | [(2R)-2-amino-2-carboxyethyl]-[[(2S,4S,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]-(6-azidohex-2-ynyl)sulfanium |
| SMILES | [N-]=[N+]=NCCCC#CC[S+](C[C@H](N)C(=O)O)C[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@@H](O)C1O |
| InChI | InChI=1S/C19H25N9O5S/c20-11(19(31)32)7-34(6-4-2-1-3-5-26-27-22)8-12-14(29)15(30)18(33-12)28-10-25-13-16(21)23-9-24-17(13)28/h9-12,14-15,18,29-30H,1,3,5-8,20H2,(H2-,21,23,24,31,32)/p+1/t11-,12+,14?,15-,18+,34?/m0/s1 |
| InChIKey | MEBSQFWWOUPSCJ-ORMMUIPHSA-O |
| XLogP | -0.85 |
| TPSA | 231.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.54 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|