C23H32N9O7S+ — CID 172538576
(3-amino-3-formyloxypropyl)-(6-azidohex-2-ynyl)-[[(2S,4S,5R)-5-[6-(2-carboxyethylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl]sulfanium (PubChem CID 172538576) has the molecular formula C23H32N9O7S+ and a molecular weight of 578.63 g/mol. Its IUPAC name is (3-amino-3-formyloxypropyl)-(6-azidohex-2-ynyl)-[[(2S,4S,5R)-5-[6-(2-carboxyethylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl]sulfanium.
| Compound Name | (3-amino-3-formyloxypropyl)-(6-azidohex-2-ynyl)-[[(2S,4S,5R)-5-[6-(2-carboxyethylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl]sulfanium |
|---|---|
| PubChem CID | 172538576 |
| Molecular Formula | C23H32N9O7S+ |
| Molecular Weight | 578.63 g/mol |
| Exact Mass | 578.21 |
| IUPAC Name | (3-amino-3-formyloxypropyl)-(6-azidohex-2-ynyl)-[[(2S,4S,5R)-5-[6-(2-carboxyethylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl]sulfanium |
| SMILES | [N-]=[N+]=NCCCC#CC[S+](CCC(N)OC=O)C[C@H]1O[C@@H](n2cnc3c(NCCC(=O)O)ncnc32)[C@@H](O)C1O |
| InChI | InChI=1S/C23H31N9O7S/c24-16(38-14-33)6-10-40(9-4-2-1-3-7-30-31-25)11-15-19(36)20(37)23(39-15)32-13-29-18-21(26-8-5-17(34)35)27-12-28-22(18)32/h12-16,19-20,23,36-37H,1,3,5-11,24H2,(H-,26,27,28,34,35)/p+1/t15-,16?,19?,20+,23-,40?/m1/s1 |
| InChIKey | LFUSXFDYAOGVSV-GTHDMESWSA-O |
| XLogP | -0.11 |
| TPSA | 243.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.63 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|